C14H20N2O2 — CID 113412127
(4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-methylfuran-3-yl)methanone (PubChem CID 113412127) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-methylfuran-3-yl)methanone.
| Compound Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 113412127 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (4-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-(2-methylfuran-3-yl)methanone |
| SMILES | Cc1occc1C(=O)N1CC2CCCC(N)C2C1 |
| InChI | InChI=1S/C14H20N2O2/c1-9-11(5-6-18-9)14(17)16-7-10-3-2-4-13(15)12(10)8-16/h5-6,10,12-13H,2-4,7-8,15H2,1H3 |
| InChIKey | SYKGASUHIYVEFW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |