C26H34N2O10 — CID 11341615
[(1S,4R)-5-[acetyl-[(E)-4-[acetyl-[(2S,5R)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enyl]amino]-4-acetyloxycyclopent-2-en-1-yl] acetate (PubChem CID 11341615) has the molecular formula C26H34N2O10 and a molecular weight of 534.56 g/mol. Its IUPAC name is [(1S,4R)-5-[acetyl-[(E)-4-[acetyl-[(2S,5R)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enyl]amino]-4-acetyloxycyclopent-2-en-1-yl] acetate.
| Compound Name | [(1S,4R)-5-[acetyl-[(E)-4-[acetyl-[(2S,5R)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enyl]amino]-4-acetyloxycyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11341615 |
| Molecular Formula | C26H34N2O10 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | [(1S,4R)-5-[acetyl-[(E)-4-[acetyl-[(2S,5R)-2,5-diacetyloxycyclopent-3-en-1-yl]amino]but-2-enyl]amino]-4-acetyloxycyclopent-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](OC(C)=O)C1N(C/C=C/CN(C(C)=O)C1[C@@H](OC(C)=O)C=C[C@H]1OC(C)=O)C(C)=O |
| InChI | InChI=1S/C26H34N2O10/c1-15(29)27(25-21(35-17(3)31)9-10-22(25)36-18(4)32)13-7-8-14-28(16(2)30)26-23(37-19(5)33)11-12-24(26)38-20(6)34/h7-12,21-26H,13-14H2,1-6H3/b8-7+/t21-,22+,23-,24+,25?,26? |
| InChIKey | LAOHSTRJTXMBNI-BUVFPKDUSA-N |
| XLogP | 0.84 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|