C9H12F3N3O2 — CID 113421686
3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)butan-2-ol (PubChem CID 113421686) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)butan-2-ol.
| Compound Name | 3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 113421686 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(3-methoxypyrazin-2-yl)butan-2-ol |
| SMILES | COc1nccnc1C(O)(C(C)N)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O2/c1-5(13)8(16,9(10,11)12)6-7(17-2)15-4-3-14-6/h3-5,16H,13H2,1-2H3 |
| InChIKey | VJXRQQOVLAKLNH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |