C11H13N3O3S — CID 113422241
2-[5-(1-methylsulfonylethyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 113422241) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-[5-(1-methylsulfonylethyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 2-[5-(1-methylsulfonylethyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 113422241 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2-[5-(1-methylsulfonylethyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | CC(c1nc(-c2ccccc2N)no1)S(C)(=O)=O |
| InChI | InChI=1S/C11H13N3O3S/c1-7(18(2,15)16)11-13-10(14-17-11)8-5-3-4-6-9(8)12/h3-7H,12H2,1-2H3 |
| InChIKey | HDHLQJHQHFOCQR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|