C12H13FN2O3S — CID 104522872
4-(2-fluorophenyl)-5-(1-methylsulfonylethyl)-1,2-oxazol-3-amine (PubChem CID 104522872) has the molecular formula C12H13FN2O3S and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-5-(1-methylsulfonylethyl)-1,2-oxazol-3-amine.
| Compound Name | 4-(2-fluorophenyl)-5-(1-methylsulfonylethyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 104522872 |
| Molecular Formula | C12H13FN2O3S |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-(2-fluorophenyl)-5-(1-methylsulfonylethyl)-1,2-oxazol-3-amine |
| SMILES | CC(c1onc(N)c1-c1ccccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C12H13FN2O3S/c1-7(19(2,16)17)11-10(12(14)15-18-11)8-5-3-4-6-9(8)13/h3-7H,1-2H3,(H2,14,15) |
| InChIKey | APNOCXQRASENHH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |