C12H17N5S — CID 113429056
N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-2-yl)ethanamine (PubChem CID 113429056) has the molecular formula C12H17N5S and a molecular weight of 263.37 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 113429056 |
| Molecular Formula | C12H17N5S |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-1-(1,3-thiazol-2-yl)ethanamine |
| SMILES | CC(NCc1nnc2n1CCCC2)c1nccs1 |
| InChI | InChI=1S/C12H17N5S/c1-9(12-13-5-7-18-12)14-8-11-16-15-10-4-2-3-6-17(10)11/h5,7,9,14H,2-4,6,8H2,1H3 |
| InChIKey | XDWWARMTIMNCCE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |