C15H23NO2 — CID 113436812
5-(4-methoxybutoxy)-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 113436812) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-(4-methoxybutoxy)-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 5-(4-methoxybutoxy)-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 113436812 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-(4-methoxybutoxy)-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | COCCCCOc1cccc2c1CCCC2N |
| InChI | InChI=1S/C15H23NO2/c1-17-10-2-3-11-18-15-9-5-6-12-13(15)7-4-8-14(12)16/h5-6,9,14H,2-4,7-8,10-11,16H2,1H3 |
| InChIKey | RXYMJYPSEJMWBA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|