C13H24N2O2 — CID 113443194
1-[5-(2,3,3-trimethylbutyl)-1,2,4-oxadiazol-3-yl]butan-1-ol (PubChem CID 113443194) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-[5-(2,3,3-trimethylbutyl)-1,2,4-oxadiazol-3-yl]butan-1-ol.
| Compound Name | 1-[5-(2,3,3-trimethylbutyl)-1,2,4-oxadiazol-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 113443194 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-[5-(2,3,3-trimethylbutyl)-1,2,4-oxadiazol-3-yl]butan-1-ol |
| SMILES | CCCC(O)c1noc(CC(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C13H24N2O2/c1-6-7-10(16)12-14-11(17-15-12)8-9(2)13(3,4)5/h9-10,16H,6-8H2,1-5H3 |
| InChIKey | KTUWUQUZOPUFRL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |