C10H10FN5O — CID 113452799
N-(4-amino-1-methylpyrazol-5-yl)-5-fluoropyridine-3-carboxamide (PubChem CID 113452799) has the molecular formula C10H10FN5O and a molecular weight of 235.22 g/mol. Its IUPAC name is N-(4-amino-1-methylpyrazol-5-yl)-5-fluoropyridine-3-carboxamide.
| Compound Name | N-(4-amino-1-methylpyrazol-5-yl)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 113452799 |
| Molecular Formula | C10H10FN5O |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-(4-amino-1-methylpyrazol-5-yl)-5-fluoropyridine-3-carboxamide |
| SMILES | Cn1ncc(N)c1NC(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C10H10FN5O/c1-16-9(8(12)5-14-16)15-10(17)6-2-7(11)4-13-3-6/h2-5H,12H2,1H3,(H,15,17) |
| InChIKey | KXOYQCQZDLHSCZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |