C11H11FN4O2 — CID 115298387
N-(4-amino-1-methylpyrazol-5-yl)-5-fluoro-2-hydroxybenzamide (PubChem CID 115298387) has the molecular formula C11H11FN4O2 and a molecular weight of 250.23 g/mol. Its IUPAC name is N-(4-amino-1-methylpyrazol-5-yl)-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-(4-amino-1-methylpyrazol-5-yl)-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 115298387 |
| Molecular Formula | C11H11FN4O2 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-(4-amino-1-methylpyrazol-5-yl)-5-fluoro-2-hydroxybenzamide |
| SMILES | Cn1ncc(N)c1NC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C11H11FN4O2/c1-16-10(8(13)5-14-16)15-11(18)7-4-6(12)2-3-9(7)17/h2-5,17H,13H2,1H3,(H,15,18) |
| InChIKey | LEHNQGQPDIMURP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |