C13H11FN4OS — CID 81105063
N-(4-amino-1-methylpyrazol-5-yl)-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 81105063) has the molecular formula C13H11FN4OS and a molecular weight of 290.32 g/mol. Its IUPAC name is N-(4-amino-1-methylpyrazol-5-yl)-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(4-amino-1-methylpyrazol-5-yl)-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 81105063 |
| Molecular Formula | C13H11FN4OS |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | N-(4-amino-1-methylpyrazol-5-yl)-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | Cn1ncc(N)c1NC(=O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C13H11FN4OS/c1-18-12(9(15)6-16-18)17-13(19)11-4-7-2-3-8(14)5-10(7)20-11/h2-6H,15H2,1H3,(H,17,19) |
| InChIKey | VCGROZKNUJAHBC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |