C13H30OSi2 — CID 11345945
trimethyl-[(3R,4R)-3-methyl-2-methylidene-4-trimethylsilyloxypentyl]silane (PubChem CID 11345945) has the molecular formula C13H30OSi2 and a molecular weight of 258.55 g/mol. Its IUPAC name is trimethyl-[(3R,4R)-3-methyl-2-methylidene-4-trimethylsilyloxypentyl]silane.
| Compound Name | trimethyl-[(3R,4R)-3-methyl-2-methylidene-4-trimethylsilyloxypentyl]silane |
|---|---|
| PubChem CID | 11345945 |
| Molecular Formula | C13H30OSi2 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | trimethyl-[(3R,4R)-3-methyl-2-methylidene-4-trimethylsilyloxypentyl]silane |
| SMILES | C=C(C[Si](C)(C)C)[C@@H](C)[C@@H](C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H30OSi2/c1-11(10-15(4,5)6)12(2)13(3)14-16(7,8)9/h12-13H,1,10H2,2-9H3/t12-,13-/m1/s1 |
| InChIKey | YFXGBYRBFRXBMM-CHWSQXEVSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|