C7H2Cl2F5N — CID 11346137
2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)aniline (PubChem CID 11346137) has the molecular formula C7H2Cl2F5N and a molecular weight of 266.00 g/mol. Its IUPAC name is 2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)aniline.
| Compound Name | 2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 11346137 |
| Molecular Formula | C7H2Cl2F5N |
| Molecular Weight | 266.00 g/mol |
| Exact Mass | 264.95 |
| IUPAC Name | 2,6-dichloro-3,5-difluoro-4-(trifluoromethyl)aniline |
| SMILES | Nc1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl |
| InChI | InChI=1S/C7H2Cl2F5N/c8-2-4(10)1(7(12,13)14)5(11)3(9)6(2)15/h15H2 |
| InChIKey | PGIKTJXLUZQBOS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.00 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|