C19H22O — CID 11346163
1,3,5-trimethyl-2-[(E)-3-phenylmethoxyprop-2-enyl]benzene (PubChem CID 11346163) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-[(E)-3-phenylmethoxyprop-2-enyl]benzene.
| Compound Name | 1,3,5-trimethyl-2-[(E)-3-phenylmethoxyprop-2-enyl]benzene |
|---|---|
| PubChem CID | 11346163 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1,3,5-trimethyl-2-[(E)-3-phenylmethoxyprop-2-enyl]benzene |
| SMILES | Cc1cc(C)c(C/C=C/OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H22O/c1-15-12-16(2)19(17(3)13-15)10-7-11-20-14-18-8-5-4-6-9-18/h4-9,11-13H,10,14H2,1-3H3/b11-7+ |
| InChIKey | UWLBVNBWLJEDOA-YRNVUSSQSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|