C12H19N3O2 — CID 113465620
1,3-dimethyl-6-[[[(E)-pent-3-enyl]amino]methyl]pyrimidine-2,4-dione (PubChem CID 113465620) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1,3-dimethyl-6-[[[(E)-pent-3-enyl]amino]methyl]pyrimidine-2,4-dione.
| Compound Name | 1,3-dimethyl-6-[[[(E)-pent-3-enyl]amino]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113465620 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1,3-dimethyl-6-[[[(E)-pent-3-enyl]amino]methyl]pyrimidine-2,4-dione |
| SMILES | C/C=C/CCNCc1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C12H19N3O2/c1-4-5-6-7-13-9-10-8-11(16)15(3)12(17)14(10)2/h4-5,8,13H,6-7,9H2,1-3H3/b5-4+ |
| InChIKey | LWUAJTYWLDLJSW-SNAWJCMRSA-N |
| XLogP | 0.14 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|