About 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol
2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol (PubChem CID 113467892) has the molecular formula C12H24N4O2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol |
| PubChem CID | 113467892 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol |
| SMILES | CNCc1c(C)nn(C)c1N(CCO)CCOC |
| InChI | InChI=1S/C12H24N4O2/c1-10-11(9-13-2)12(15(3)14-10)16(5-7-17)6-8-18-4/h13,17H,5-9H2,1-4H3 |
| InChIKey | MXSOIBBVBYAFJV-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol?
The IUPAC name of 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol (CID 113467892) is 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol.
What is the SMILES notation for 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol?
The canonical SMILES for 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol is CNCc1c(C)nn(C)c1N(CCO)CCOC.
What is the InChIKey of 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol?
The InChIKey is MXSOIBBVBYAFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O2/c1-10-11(9-13-2)12(15(3)14-10)16(5-7-17)6-8-18-4/h13,17H,5-9H2,1-4H3.
What are the key properties of 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol?
2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol has a molecular weight of 256.35 g/mol, XLogP of -0.11, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1,3-dimethyl-4-(methylaminomethyl)pyrazol-5-yl]-(2-methoxyethyl)amino]ethanol is sourced from PubChem (CID 113467892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).