C12H19ClN4O — CID 63285169
3-[[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-(2-methoxyethyl)amino]propanenitrile (PubChem CID 63285169) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 3-[[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-(2-methoxyethyl)amino]propanenitrile.
| Compound Name | 3-[[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-(2-methoxyethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 63285169 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[[4-(chloromethyl)-1,3-dimethylpyrazol-5-yl]-(2-methoxyethyl)amino]propanenitrile |
| SMILES | COCCN(CCC#N)c1c(CCl)c(C)nn1C |
| InChI | InChI=1S/C12H19ClN4O/c1-10-11(9-13)12(16(2)15-10)17(6-4-5-14)7-8-18-3/h4,6-9H2,1-3H3 |
| InChIKey | CAFMQOOQYXHSRX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|