C12H23ClN4O — CID 113468138
N-(2-chloroethyl)-2-methoxy-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine (PubChem CID 113468138) has the molecular formula C12H23ClN4O and a molecular weight of 274.80 g/mol. Its IUPAC name is N-(2-chloroethyl)-2-methoxy-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine.
| Compound Name | N-(2-chloroethyl)-2-methoxy-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 113468138 |
| Molecular Formula | C12H23ClN4O |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-(2-chloroethyl)-2-methoxy-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]ethanamine |
| SMILES | COCCN(CCCl)Cc1ncnn1CC(C)C |
| InChI | InChI=1S/C12H23ClN4O/c1-11(2)8-17-12(14-10-15-17)9-16(5-4-13)6-7-18-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | PIKJKCYLGRUBFV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|