C12H23BrN4 — CID 80671178
N-(2-bromoethyl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]propan-2-amine (PubChem CID 80671178) has the molecular formula C12H23BrN4 and a molecular weight of 303.25 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]propan-2-amine.
| Compound Name | N-(2-bromoethyl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 80671178 |
| Molecular Formula | C12H23BrN4 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-(2-bromoethyl)-N-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)Cn1ncnc1CN(CCBr)C(C)C |
| InChI | InChI=1S/C12H23BrN4/c1-10(2)7-17-12(14-9-15-17)8-16(6-5-13)11(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey | KEMOVBGSEQZERQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|