C11H21BrN4 — CID 80691392
3-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine (PubChem CID 80691392) has the molecular formula C11H21BrN4 and a molecular weight of 289.22 g/mol. Its IUPAC name is 3-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 80691392 |
| Molecular Formula | C11H21BrN4 |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-propan-2-ylpropan-1-amine |
| SMILES | CCn1ncnc1CN(CCCBr)C(C)C |
| InChI | InChI=1S/C11H21BrN4/c1-4-16-11(13-9-14-16)8-15(10(2)3)7-5-6-12/h9-10H,4-8H2,1-3H3 |
| InChIKey | UTWZPRQNLYHCNW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|