C8H15BrN4 — CID 80673751
2-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methylethanamine (PubChem CID 80673751) has the molecular formula C8H15BrN4 and a molecular weight of 247.14 g/mol. Its IUPAC name is 2-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methylethanamine.
| Compound Name | 2-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 80673751 |
| Molecular Formula | C8H15BrN4 |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-bromo-N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methylethanamine |
| SMILES | CCn1ncnc1CN(C)CCBr |
| InChI | InChI=1S/C8H15BrN4/c1-3-13-8(10-7-11-13)6-12(2)5-4-9/h7H,3-6H2,1-2H3 |
| InChIKey | RDFFMOFBKFNLTA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|