C10H19BrN4 — CID 80668114
2-bromo-N-methyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]propan-1-amine (PubChem CID 80668114) has the molecular formula C10H19BrN4 and a molecular weight of 275.19 g/mol. Its IUPAC name is 2-bromo-N-methyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]propan-1-amine.
| Compound Name | 2-bromo-N-methyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80668114 |
| Molecular Formula | C10H19BrN4 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-bromo-N-methyl-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]propan-1-amine |
| SMILES | CCCn1ncnc1CN(C)CC(C)Br |
| InChI | InChI=1S/C10H19BrN4/c1-4-5-15-10(12-8-13-15)7-14(3)6-9(2)11/h8-9H,4-7H2,1-3H3 |
| InChIKey | JHJICYFRJPZKDZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|