C11H19BrN4 — CID 80668920
N-(2-bromoethyl)-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclopropanamine (PubChem CID 80668920) has the molecular formula C11H19BrN4 and a molecular weight of 287.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclopropanamine.
| Compound Name | N-(2-bromoethyl)-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 80668920 |
| Molecular Formula | C11H19BrN4 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-(2-bromoethyl)-N-[(2-propyl-1,2,4-triazol-3-yl)methyl]cyclopropanamine |
| SMILES | CCCn1ncnc1CN(CCBr)C1CC1 |
| InChI | InChI=1S/C11H19BrN4/c1-2-6-16-11(13-9-14-16)8-15(7-5-12)10-3-4-10/h9-10H,2-8H2,1H3 |
| InChIKey | GIUHCIBGBHNEIB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|