C9H18N6O — CID 77098649
N'-hydroxy-2-[methyl-[(2-propyl-1,2,4-triazol-3-yl)methyl]amino]ethanimidamide (PubChem CID 77098649) has the molecular formula C9H18N6O and a molecular weight of 226.28 g/mol. Its IUPAC name is N'-hydroxy-2-[methyl-[(2-propyl-1,2,4-triazol-3-yl)methyl]amino]ethanimidamide.
| Compound Name | N'-hydroxy-2-[methyl-[(2-propyl-1,2,4-triazol-3-yl)methyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 77098649 |
| Molecular Formula | C9H18N6O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N'-hydroxy-2-[methyl-[(2-propyl-1,2,4-triazol-3-yl)methyl]amino]ethanimidamide |
| SMILES | CCCn1ncnc1CN(C)CC(N)=NO |
| InChI | InChI=1S/C9H18N6O/c1-3-4-15-9(11-7-12-15)6-14(2)5-8(10)13-16/h7,16H,3-6H2,1-2H3,(H2,10,13) |
| InChIKey | BTYWTBMLDILQNN-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|