C17H24N4O — CID 46987913
N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methyl-2-(2-prop-2-enylphenoxy)ethanamine (PubChem CID 46987913) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methyl-2-(2-prop-2-enylphenoxy)ethanamine.
| Compound Name | N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methyl-2-(2-prop-2-enylphenoxy)ethanamine |
|---|---|
| PubChem CID | 46987913 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-N-methyl-2-(2-prop-2-enylphenoxy)ethanamine |
| SMILES | C=CCc1ccccc1OCCN(C)Cc1ncnn1CC |
| InChI | InChI=1S/C17H24N4O/c1-4-8-15-9-6-7-10-16(15)22-12-11-20(3)13-17-18-14-19-21(17)5-2/h4,6-7,9-10,14H,1,5,8,11-13H2,2-3H3 |
| InChIKey | QWRBHDMJBRZVOM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|