C12H15Cl2NO4S — CID 113470451
3-chloro-5-[(1-methoxy-2-methylpropan-2-yl)carbamoyl]benzenesulfonyl chloride (PubChem CID 113470451) has the molecular formula C12H15Cl2NO4S and a molecular weight of 340.23 g/mol. Its IUPAC name is 3-chloro-5-[(1-methoxy-2-methylpropan-2-yl)carbamoyl]benzenesulfonyl chloride.
| Compound Name | 3-chloro-5-[(1-methoxy-2-methylpropan-2-yl)carbamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 113470451 |
| Molecular Formula | C12H15Cl2NO4S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 3-chloro-5-[(1-methoxy-2-methylpropan-2-yl)carbamoyl]benzenesulfonyl chloride |
| SMILES | COCC(C)(C)NC(=O)c1cc(Cl)cc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO4S/c1-12(2,7-19-3)15-11(16)8-4-9(13)6-10(5-8)20(14,17)18/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | UVLLPTQQZUCUFT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |