About [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate
[3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate (PubChem CID 54083760) has the molecular formula C13H15Cl2NO5S
and a molecular weight of 368.24 g/mol. Its IUPAC name is [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate.
Molecular Properties
| Compound Name | [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate |
| PubChem CID | 54083760 |
| Molecular Formula | C13H15Cl2NO5S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate |
| SMILES | CC(C)(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)COS(C)(=O)=O |
| InChI | InChI=1S/C13H15Cl2NO5S/c1-13(2,11(17)7-21-22(3,19)20)16-12(18)8-4-9(14)6-10(15)5-8/h4-6H,7H2,1-3H3,(H,16,18) |
| InChIKey | MOYPZSLUAMMTGF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate?
The IUPAC name of [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate (CID 54083760) is [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate.
What is the SMILES notation for [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate?
The canonical SMILES for [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate is CC(C)(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)COS(C)(=O)=O.
What is the InChIKey of [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate?
The InChIKey is MOYPZSLUAMMTGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2NO5S/c1-13(2,11(17)7-21-22(3,19)20)16-12(18)8-4-9(14)6-10(15)5-8/h4-6H,7H2,1-3H3,(H,16,18).
What are the key properties of [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate?
[3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate has a molecular weight of 368.24 g/mol, XLogP of 2.05, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,5-dichlorobenzoyl)amino]-3-methyl-2-oxobutyl] methanesulfonate is sourced from PubChem (CID 54083760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).