C19H15Cl4NO4 — CID 15754056
(4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate (PubChem CID 15754056) has the molecular formula C19H15Cl4NO4 and a molecular weight of 463.14 g/mol. Its IUPAC name is (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate.
| Compound Name | (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate |
|---|---|
| PubChem CID | 15754056 |
| Molecular Formula | C19H15Cl4NO4 |
| Molecular Weight | 463.14 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate |
| SMILES | CC(C)(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)C(Cl)C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15Cl4NO4/c1-19(2,24-17(26)10-7-12(21)9-13(22)8-10)16(25)15(23)18(27)28-14-5-3-11(20)4-6-14/h3-9,15H,1-2H3,(H,24,26) |
| InChIKey | KXMFSBMTYZFXQY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.14 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|