About (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate
(4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate (PubChem CID 15754056) has the molecular formula C19H15Cl4NO4
and a molecular weight of 463.14 g/mol. Its IUPAC name is (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate.
Molecular Properties
| Compound Name | (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate |
| PubChem CID | 15754056 |
| Molecular Formula | C19H15Cl4NO4 |
| Molecular Weight | 463.14 g/mol |
| Exact Mass | 460.98 |
| IUPAC Name | (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate |
| SMILES | CC(C)(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)C(Cl)C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15Cl4NO4/c1-19(2,24-17(26)10-7-12(21)9-13(22)8-10)16(25)15(23)18(27)28-14-5-3-11(20)4-6-14/h3-9,15H,1-2H3,(H,24,26) |
| InChIKey | KXMFSBMTYZFXQY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.14 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate?
The IUPAC name of (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate (CID 15754056) is (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate.
What is the SMILES notation for (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate?
The canonical SMILES for (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate is CC(C)(NC(=O)c1cc(Cl)cc(Cl)c1)C(=O)C(Cl)C(=O)Oc1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate?
The InChIKey is KXMFSBMTYZFXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl4NO4/c1-19(2,24-17(26)10-7-12(21)9-13(22)8-10)16(25)15(23)18(27)28-14-5-3-11(20)4-6-14/h3-9,15H,1-2H3,(H,24,26).
What are the key properties of (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate?
(4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate has a molecular weight of 463.14 g/mol, XLogP of 4.94, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl) 2-chloro-4-[(3,5-dichlorobenzoyl)amino]-4-methyl-3-oxopentanoate is sourced from PubChem (CID 15754056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).