C14H17Cl2NO2S — CID 54220848
3,5-dichloro-N-(4-ethylsulfanyl-2-methyl-3-oxobutan-2-yl)benzamide (PubChem CID 54220848) has the molecular formula C14H17Cl2NO2S and a molecular weight of 334.27 g/mol. Its IUPAC name is 3,5-dichloro-N-(4-ethylsulfanyl-2-methyl-3-oxobutan-2-yl)benzamide.
| Compound Name | 3,5-dichloro-N-(4-ethylsulfanyl-2-methyl-3-oxobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 54220848 |
| Molecular Formula | C14H17Cl2NO2S |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3,5-dichloro-N-(4-ethylsulfanyl-2-methyl-3-oxobutan-2-yl)benzamide |
| SMILES | CCSCC(=O)C(C)(C)NC(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO2S/c1-4-20-8-12(18)14(2,3)17-13(19)9-5-10(15)7-11(16)6-9/h5-7H,4,8H2,1-3H3,(H,17,19) |
| InChIKey | QCMGUOLNQLKTRB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |