C15H20N2O5 — CID 11347371
tert-butyl 2-hydroxy-4-(4-nitrophenyl)pyrrolidine-1-carboxylate (PubChem CID 11347371) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is tert-butyl 2-hydroxy-4-(4-nitrophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-hydroxy-4-(4-nitrophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11347371 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | tert-butyl 2-hydroxy-4-(4-nitrophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc([N+](=O)[O-])cc2)CC1O |
| InChI | InChI=1S/C15H20N2O5/c1-15(2,3)22-14(19)16-9-11(8-13(16)18)10-4-6-12(7-5-10)17(20)21/h4-7,11,13,18H,8-9H2,1-3H3 |
| InChIKey | QUDPVYQKHFSQQZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|