About 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate
4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate (PubChem CID 6733648) has the molecular formula C15H20N2O5
and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate |
| PubChem CID | 6733648 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate |
| SMILES | O=C(OCCCCc1ccc([N+](=O)[O-])cc1)N1CCC(O)C1 |
| InChI | InChI=1S/C15H20N2O5/c18-14-8-9-16(11-14)15(19)22-10-2-1-3-12-4-6-13(7-5-12)17(20)21/h4-7,14,18H,1-3,8-11H2 |
| InChIKey | YRQUCQNWGFLHHT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate?
The IUPAC name of 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate (CID 6733648) is 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate.
What is the SMILES notation for 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate?
The canonical SMILES for 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate is O=C(OCCCCc1ccc([N+](=O)[O-])cc1)N1CCC(O)C1.
What is the InChIKey of 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate?
The InChIKey is YRQUCQNWGFLHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O5/c18-14-8-9-16(11-14)15(19)22-10-2-1-3-12-4-6-13(7-5-12)17(20)21/h4-7,14,18H,1-3,8-11H2.
What are the key properties of 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate?
4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate has a molecular weight of 308.33 g/mol, XLogP of 2.12, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-nitrophenyl)butyl 3-hydroxypyrrolidine-1-carboxylate is sourced from PubChem (CID 6733648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).