C14H20O3S2 — CID 113474055
2-(3-ethylsulfanylpropylsulfinyl)-3-phenylpropanoic acid (PubChem CID 113474055) has the molecular formula C14H20O3S2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 2-(3-ethylsulfanylpropylsulfinyl)-3-phenylpropanoic acid.
| Compound Name | 2-(3-ethylsulfanylpropylsulfinyl)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 113474055 |
| Molecular Formula | C14H20O3S2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(3-ethylsulfanylpropylsulfinyl)-3-phenylpropanoic acid |
| SMILES | CCSCCCS(=O)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20O3S2/c1-2-18-9-6-10-19(17)13(14(15)16)11-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3,(H,15,16) |
| InChIKey | SIOYVBPZXQJXSL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|