C12H14N4O3S — CID 107051992
2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3-phenylpropanoic acid (PubChem CID 107051992) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3-phenylpropanoic acid.
| Compound Name | 2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 107051992 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[(2-methyltetrazol-5-yl)methylsulfinyl]-3-phenylpropanoic acid |
| SMILES | Cn1nnc(CS(=O)C(Cc2ccccc2)C(=O)O)n1 |
| InChI | InChI=1S/C12H14N4O3S/c1-16-14-11(13-15-16)8-20(19)10(12(17)18)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,17,18) |
| InChIKey | RQIZLCUFOITLFO-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |