C15H32N2S — CID 113474527
2,5-ditert-butyl-1-(2-methylsulfanylethyl)piperazine (PubChem CID 113474527) has the molecular formula C15H32N2S and a molecular weight of 272.50 g/mol. Its IUPAC name is 2,5-ditert-butyl-1-(2-methylsulfanylethyl)piperazine.
| Compound Name | 2,5-ditert-butyl-1-(2-methylsulfanylethyl)piperazine |
|---|---|
| PubChem CID | 113474527 |
| Molecular Formula | C15H32N2S |
| Molecular Weight | 272.50 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2,5-ditert-butyl-1-(2-methylsulfanylethyl)piperazine |
| SMILES | CSCCN1CC(C(C)(C)C)NCC1C(C)(C)C |
| InChI | InChI=1S/C15H32N2S/c1-14(2,3)12-11-17(8-9-18-7)13(10-16-12)15(4,5)6/h12-13,16H,8-11H2,1-7H3 |
| InChIKey | YLXYHSALYXVNPU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |