C13H18N2O2S2 — CID 113474823
1-(2-ethylsulfanylethyl)-2-methylindole-3-sulfonamide (PubChem CID 113474823) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethyl)-2-methylindole-3-sulfonamide.
| Compound Name | 1-(2-ethylsulfanylethyl)-2-methylindole-3-sulfonamide |
|---|---|
| PubChem CID | 113474823 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(2-ethylsulfanylethyl)-2-methylindole-3-sulfonamide |
| SMILES | CCSCCn1c(C)c(S(N)(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C13H18N2O2S2/c1-3-18-9-8-15-10(2)13(19(14,16)17)11-6-4-5-7-12(11)15/h4-7H,3,8-9H2,1-2H3,(H2,14,16,17) |
| InChIKey | DYJQKDXIGVDLNZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|