C14H21NO2S — CID 113486983
1-(2-methyl-1,3-thiazol-4-yl)decane-1,3-dione (PubChem CID 113486983) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)decane-1,3-dione.
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)decane-1,3-dione |
|---|---|
| PubChem CID | 113486983 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)decane-1,3-dione |
| SMILES | CCCCCCCC(=O)CC(=O)c1csc(C)n1 |
| InChI | InChI=1S/C14H21NO2S/c1-3-4-5-6-7-8-12(16)9-14(17)13-10-18-11(2)15-13/h10H,3-9H2,1-2H3 |
| InChIKey | QKIHQWBSKNFGCN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|