C13H18N4O — CID 113488928
3-(1-ethylcyclobutyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine (PubChem CID 113488928) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(1-ethylcyclobutyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(1-ethylcyclobutyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 113488928 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-(1-ethylcyclobutyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine |
| SMILES | CCC1(n2c(N)nc3ccc(OC)nc32)CCC1 |
| InChI | InChI=1S/C13H18N4O/c1-3-13(7-4-8-13)17-11-9(15-12(17)14)5-6-10(16-11)18-2/h5-6H,3-4,7-8H2,1-2H3,(H2,14,15) |
| InChIKey | DCAVYKUGFGQUSZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |