C14H20N4O — CID 115322201
3-(cyclohexylmethyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine (PubChem CID 115322201) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(cyclohexylmethyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 115322201 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-(cyclohexylmethyl)-5-methoxyimidazo[4,5-b]pyridin-2-amine |
| SMILES | COc1ccc2nc(N)n(CC3CCCCC3)c2n1 |
| InChI | InChI=1S/C14H20N4O/c1-19-12-8-7-11-13(17-12)18(14(15)16-11)9-10-5-3-2-4-6-10/h7-8,10H,2-6,9H2,1H3,(H2,15,16) |
| InChIKey | OPWWIYBZUFDNPA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |