C11H14N4O2 — CID 113286877
5-methoxy-3-(oxolan-3-yl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 113286877) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-methoxy-3-(oxolan-3-yl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 5-methoxy-3-(oxolan-3-yl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 113286877 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 5-methoxy-3-(oxolan-3-yl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | COc1ccc2nc(N)n(C3CCOC3)c2n1 |
| InChI | InChI=1S/C11H14N4O2/c1-16-9-3-2-8-10(14-9)15(11(12)13-8)7-4-5-17-6-7/h2-3,7H,4-6H2,1H3,(H2,12,13) |
| InChIKey | GXYFXFYLOOWUDW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |