C15H22N4O — CID 115322469
5-methoxy-3-(2-methylcycloheptyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 115322469) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 5-methoxy-3-(2-methylcycloheptyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 5-methoxy-3-(2-methylcycloheptyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 115322469 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 5-methoxy-3-(2-methylcycloheptyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | COc1ccc2nc(N)n(C3CCCCCC3C)c2n1 |
| InChI | InChI=1S/C15H22N4O/c1-10-6-4-3-5-7-12(10)19-14-11(17-15(19)16)8-9-13(18-14)20-2/h8-10,12H,3-7H2,1-2H3,(H2,16,17) |
| InChIKey | ZBBXPIKWYHJYJJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |