C11H16N2O3S2 — CID 113489671
1-(1,4-dithian-2-ylmethyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione (PubChem CID 113489671) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-(1,4-dithian-2-ylmethyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(1,4-dithian-2-ylmethyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 113489671 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 1-(1,4-dithian-2-ylmethyl)-5-ethyl-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCc1c(O)n(CC2CSCCS2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N2O3S2/c1-2-8-9(14)12-11(16)13(10(8)15)5-7-6-17-3-4-18-7/h7,15H,2-6H2,1H3,(H,12,14,16) |
| InChIKey | BGYVHIHUSFZQJS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |