C13H28N2OS — CID 113490855
4-ethyl-1-(3-methylsulfinylbutyl)-1,5-diazocane (PubChem CID 113490855) has the molecular formula C13H28N2OS and a molecular weight of 260.45 g/mol. Its IUPAC name is 4-ethyl-1-(3-methylsulfinylbutyl)-1,5-diazocane.
| Compound Name | 4-ethyl-1-(3-methylsulfinylbutyl)-1,5-diazocane |
|---|---|
| PubChem CID | 113490855 |
| Molecular Formula | C13H28N2OS |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-ethyl-1-(3-methylsulfinylbutyl)-1,5-diazocane |
| SMILES | CCC1CCN(CCC(C)S(C)=O)CCCN1 |
| InChI | InChI=1S/C13H28N2OS/c1-4-13-7-11-15(9-5-8-14-13)10-6-12(2)17(3)16/h12-14H,4-11H2,1-3H3 |
| InChIKey | KFJNDRYRXOUAIA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |