C16H13Cl2N5S — CID 11349446
8-(2,4-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine (PubChem CID 11349446) has the molecular formula C16H13Cl2N5S and a molecular weight of 378.29 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine.
| Compound Name | 8-(2,4-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine |
|---|---|
| PubChem CID | 11349446 |
| Molecular Formula | C16H13Cl2N5S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 8-(2,4-dichlorophenyl)sulfanyl-9-pent-4-ynylpurin-6-amine |
| SMILES | C#CCCCn1c(Sc2ccc(Cl)cc2Cl)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H13Cl2N5S/c1-2-3-4-7-23-15-13(14(19)20-9-21-15)22-16(23)24-12-6-5-10(17)8-11(12)18/h1,5-6,8-9H,3-4,7H2,(H2,19,20,21) |
| InChIKey | KNFKPQJGTFXNMB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|