C11H20N2O2S2 — CID 113494787
1-carbamothioyl-N-(2-ethylsulfinylethyl)-3-methylcyclobutane-1-carboxamide (PubChem CID 113494787) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2-ethylsulfinylethyl)-3-methylcyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2-ethylsulfinylethyl)-3-methylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 113494787 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-carbamothioyl-N-(2-ethylsulfinylethyl)-3-methylcyclobutane-1-carboxamide |
| SMILES | CCS(=O)CCNC(=O)C1(C(N)=S)CC(C)C1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-3-17(15)5-4-13-10(14)11(9(12)16)6-8(2)7-11/h8H,3-7H2,1-2H3,(H2,12,16)(H,13,14) |
| InChIKey | AIIWZGQJZJKJFX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|