C14H25N3O2S — CID 80592759
1-carbamothioyl-3-methyl-N-(3-morpholin-4-ylpropyl)cyclobutane-1-carboxamide (PubChem CID 80592759) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-carbamothioyl-3-methyl-N-(3-morpholin-4-ylpropyl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-3-methyl-N-(3-morpholin-4-ylpropyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80592759 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-carbamothioyl-3-methyl-N-(3-morpholin-4-ylpropyl)cyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)NCCCN2CCOCC2)(C(N)=S)C1 |
| InChI | InChI=1S/C14H25N3O2S/c1-11-9-14(10-11,12(15)20)13(18)16-3-2-4-17-5-7-19-8-6-17/h11H,2-10H2,1H3,(H2,15,20)(H,16,18) |
| InChIKey | BBEHMYMACJQBDP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|