C13H18BrNO3 — CID 113496406
N-(1-bromopentan-3-yl)-2-hydroxy-4-methoxybenzamide (PubChem CID 113496406) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is N-(1-bromopentan-3-yl)-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-(1-bromopentan-3-yl)-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 113496406 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(1-bromopentan-3-yl)-2-hydroxy-4-methoxybenzamide |
| SMILES | CCC(CCBr)NC(=O)c1ccc(OC)cc1O |
| InChI | InChI=1S/C13H18BrNO3/c1-3-9(6-7-14)15-13(17)11-5-4-10(18-2)8-12(11)16/h4-5,8-9,16H,3,6-7H2,1-2H3,(H,15,17) |
| InChIKey | FQCVUJDRMDESLV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|