C14H22N2O2 — CID 113496986
3-amino-N-(4-hydroxyphenyl)-5,5-dimethylhexanamide (PubChem CID 113496986) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-amino-N-(4-hydroxyphenyl)-5,5-dimethylhexanamide.
| Compound Name | 3-amino-N-(4-hydroxyphenyl)-5,5-dimethylhexanamide |
|---|---|
| PubChem CID | 113496986 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-amino-N-(4-hydroxyphenyl)-5,5-dimethylhexanamide |
| SMILES | CC(C)(C)CC(N)CC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C14H22N2O2/c1-14(2,3)9-10(15)8-13(18)16-11-4-6-12(17)7-5-11/h4-7,10,17H,8-9,15H2,1-3H3,(H,16,18) |
| InChIKey | RPLIEBOJZFNWJT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|