C14H21NO2 — CID 113497582
1-(2,3-dihydro-1-benzofuran-3-ylmethylamino)pentan-3-ol (PubChem CID 113497582) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-3-ylmethylamino)pentan-3-ol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-3-ylmethylamino)pentan-3-ol |
|---|---|
| PubChem CID | 113497582 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-3-ylmethylamino)pentan-3-ol |
| SMILES | CCC(O)CCNCC1COc2ccccc21 |
| InChI | InChI=1S/C14H21NO2/c1-2-12(16)7-8-15-9-11-10-17-14-6-4-3-5-13(11)14/h3-6,11-12,15-16H,2,7-10H2,1H3 |
| InChIKey | OSPBHUUYRGMPCF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|