C14H21NO3 — CID 114163594
4-(2,3-dihydro-1-benzofuran-3-ylmethylamino)-1-methoxybutan-2-ol (PubChem CID 114163594) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzofuran-3-ylmethylamino)-1-methoxybutan-2-ol.
| Compound Name | 4-(2,3-dihydro-1-benzofuran-3-ylmethylamino)-1-methoxybutan-2-ol |
|---|---|
| PubChem CID | 114163594 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 4-(2,3-dihydro-1-benzofuran-3-ylmethylamino)-1-methoxybutan-2-ol |
| SMILES | COCC(O)CCNCC1COc2ccccc21 |
| InChI | InChI=1S/C14H21NO3/c1-17-10-12(16)6-7-15-8-11-9-18-14-5-3-2-4-13(11)14/h2-5,11-12,15-16H,6-10H2,1H3 |
| InChIKey | OUYPZEPYPXGFEK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|