C12H16ClNO3S — CID 113498824
4-chloro-3-(hydroxymethyl)-N-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide (PubChem CID 113498824) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is 4-chloro-3-(hydroxymethyl)-N-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide.
| Compound Name | 4-chloro-3-(hydroxymethyl)-N-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113498824 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-chloro-3-(hydroxymethyl)-N-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
| SMILES | C=C(C)CN(C)S(=O)(=O)c1ccc(Cl)c(CO)c1 |
| InChI | InChI=1S/C12H16ClNO3S/c1-9(2)7-14(3)18(16,17)11-4-5-12(13)10(6-11)8-15/h4-6,15H,1,7-8H2,2-3H3 |
| InChIKey | XWUYWTJJSSNOTI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|